C33H37F3N10O5S — CID 70098969
(2R,3R,4S,5R)-2-[6-(2,2-diphenylethylamino)-2-(thian-4-ylamino)purin-9-yl]-5-(2-ethyltetrazol-5-yl)oxolane-3,4-diol;2,2,2-trifluoroacetic acid (PubChem CID 70098969) has the molecular formula C33H37F3N10O5S and a molecular weight of 742.79 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-(2,2-diphenylethylamino)-2-(thian-4-ylamino)purin-9-yl]-5-(2-ethyltetrazol-5-yl)oxolane-3,4-diol;2,2,2-trifluoroacetic acid.
| Compound Name | (2R,3R,4S,5R)-2-[6-(2,2-diphenylethylamino)-2-(thian-4-ylamino)purin-9-yl]-5-(2-ethyltetrazol-5-yl)oxolane-3,4-diol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70098969 |
| Molecular Formula | C33H37F3N10O5S |
| Molecular Weight | 742.79 g/mol |
| Exact Mass | 742.26 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-(2,2-diphenylethylamino)-2-(thian-4-ylamino)purin-9-yl]-5-(2-ethyltetrazol-5-yl)oxolane-3,4-diol;2,2,2-trifluoroacetic acid |
| SMILES | CCn1nnc([C@H]2O[C@@H](n3cnc4c(NCC(c5ccccc5)c5ccccc5)nc(NC5CCSCC5)nc43)[C@H](O)[C@@H]2O)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C31H36N10O3S.C2HF3O2/c1-2-41-38-28(37-39-41)26-24(42)25(43)30(44-26)40-18-33-23-27(35-31(36-29(23)40)34-21-13-15-45-16-14-21)32-17-22(19-9-5-3-6-10-19)20-11-7-4-8-12-20;3-2(4,5)1(6)7/h3-12,18,21-22,24-26,30,42-43H,2,13-17H2,1H3,(H2,32,34,35,36);(H,6,7)/t24-,25+,26-,30+;/m0./s1 |
| InChIKey | YTJRBQCUJYJMMS-UQLHYQDLSA-N |
| XLogP | 4.01 |
| TPSA | 198.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.79 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |