C34H38F3N11O4 — CID 68965290
[(2R,3S,4R,5R)-5-[2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-6-(2,2-diphenylethylamino)purin-9-yl]-2-(2-ethyltetrazol-5-yl)-4-hydroxyoxolan-3-yl] 2,2,2-trifluoroacetate (PubChem CID 68965290) has the molecular formula C34H38F3N11O4 and a molecular weight of 721.75 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-6-(2,2-diphenylethylamino)purin-9-yl]-2-(2-ethyltetrazol-5-yl)-4-hydroxyoxolan-3-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(2R,3S,4R,5R)-5-[2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-6-(2,2-diphenylethylamino)purin-9-yl]-2-(2-ethyltetrazol-5-yl)-4-hydroxyoxolan-3-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68965290 |
| Molecular Formula | C34H38F3N11O4 |
| Molecular Weight | 721.75 g/mol |
| Exact Mass | 721.31 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-6-(2,2-diphenylethylamino)purin-9-yl]-2-(2-ethyltetrazol-5-yl)-4-hydroxyoxolan-3-yl] 2,2,2-trifluoroacetate |
| SMILES | CCn1nnc([C@H]2O[C@@H](n3cnc4c(NCC(c5ccccc5)c5ccccc5)nc(N5CC[C@@H](N(C)C)C5)nc43)[C@H](O)[C@@H]2OC(=O)C(F)(F)F)n1 |
| InChI | InChI=1S/C34H38F3N11O4/c1-4-48-43-29(42-44-48)27-26(52-32(50)34(35,36)37)25(49)31(51-27)47-19-39-24-28(40-33(41-30(24)47)46-16-15-22(18-46)45(2)3)38-17-23(20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-14,19,22-23,25-27,31,49H,4,15-18H2,1-3H3,(H,38,40,41)/t22-,25-,26+,27+,31-/m1/s1 |
| InChIKey | FNUAKSCPQWELNL-PWPSHIBHSA-N |
| XLogP | 3.32 |
| TPSA | 161.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.75 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |