C26H34Cl2N12O3 — CID 70025540
(2R,3S,4R,5R)-2-(2-ethyltetrazol-5-yl)-5-[2-[2-(1-methylimidazol-4-yl)ethylamino]-6-(2-phenylethylamino)purin-9-yl]oxolane-3,4-diol;dihydrochloride (PubChem CID 70025540) has the molecular formula C26H34Cl2N12O3 and a molecular weight of 633.55 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(2-ethyltetrazol-5-yl)-5-[2-[2-(1-methylimidazol-4-yl)ethylamino]-6-(2-phenylethylamino)purin-9-yl]oxolane-3,4-diol;dihydrochloride.
| Compound Name | (2R,3S,4R,5R)-2-(2-ethyltetrazol-5-yl)-5-[2-[2-(1-methylimidazol-4-yl)ethylamino]-6-(2-phenylethylamino)purin-9-yl]oxolane-3,4-diol;dihydrochloride |
|---|---|
| PubChem CID | 70025540 |
| Molecular Formula | C26H34Cl2N12O3 |
| Molecular Weight | 633.55 g/mol |
| Exact Mass | 632.23 |
| IUPAC Name | (2R,3S,4R,5R)-2-(2-ethyltetrazol-5-yl)-5-[2-[2-(1-methylimidazol-4-yl)ethylamino]-6-(2-phenylethylamino)purin-9-yl]oxolane-3,4-diol;dihydrochloride |
| SMILES | CCn1nnc([C@H]2O[C@@H](n3cnc4c(NCCc5ccccc5)nc(NCCc5cn(C)cn5)nc43)[C@H](O)[C@@H]2O)n1.Cl.Cl |
| InChI | InChI=1S/C26H32N12O3.2ClH/c1-3-38-34-23(33-35-38)21-19(39)20(40)25(41-21)37-15-30-18-22(27-11-9-16-7-5-4-6-8-16)31-26(32-24(18)37)28-12-10-17-13-36(2)14-29-17;;/h4-8,13-15,19-21,25,39-40H,3,9-12H2,1-2H3,(H2,27,28,31,32);2*1H/t19-,20+,21-,25+;;/m0../s1 |
| InChIKey | XXGHVXBHSFNMIL-CFGLYVENSA-N |
| XLogP | 1.71 |
| TPSA | 178.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.55 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |