C27H34N12O6 — CID 70025436
formic acid;(2R,3R,4S,5R)-2-[6-[hydroxymethyl(2-phenylethyl)amino]-2-[2-(1-methylimidazol-4-yl)ethylamino]purin-9-yl]-5-(2-methyltetrazol-5-yl)oxolane-3,4-diol (PubChem CID 70025436) has the molecular formula C27H34N12O6 and a molecular weight of 622.65 g/mol. Its IUPAC name is formic acid;(2R,3R,4S,5R)-2-[6-[hydroxymethyl(2-phenylethyl)amino]-2-[2-(1-methylimidazol-4-yl)ethylamino]purin-9-yl]-5-(2-methyltetrazol-5-yl)oxolane-3,4-diol.
| Compound Name | formic acid;(2R,3R,4S,5R)-2-[6-[hydroxymethyl(2-phenylethyl)amino]-2-[2-(1-methylimidazol-4-yl)ethylamino]purin-9-yl]-5-(2-methyltetrazol-5-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 70025436 |
| Molecular Formula | C27H34N12O6 |
| Molecular Weight | 622.65 g/mol |
| Exact Mass | 622.27 |
| IUPAC Name | formic acid;(2R,3R,4S,5R)-2-[6-[hydroxymethyl(2-phenylethyl)amino]-2-[2-(1-methylimidazol-4-yl)ethylamino]purin-9-yl]-5-(2-methyltetrazol-5-yl)oxolane-3,4-diol |
| SMILES | Cn1cnc(CCNc2nc(N(CO)CCc3ccccc3)c3ncn([C@@H]4O[C@H](c5nnn(C)n5)[C@@H](O)[C@H]4O)c3n2)c1.O=CO |
| InChI | InChI=1S/C26H32N12O4.CH2O2/c1-35-12-17(28-13-35)8-10-27-26-30-23(37(15-39)11-9-16-6-4-3-5-7-16)18-24(31-26)38(14-29-18)25-20(41)19(40)21(42-25)22-32-34-36(2)33-22;2-1-3/h3-7,12-14,19-21,25,39-41H,8-11,15H2,1-2H3,(H,27,30,31);1H,(H,2,3)/t19-,20+,21-,25+;/m0./s1 |
| InChIKey | UODOPXQNKRAZJN-PTBFWKJXSA-N |
| XLogP | -0.57 |
| TPSA | 227.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.65 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|