C27H29IN10O4 — CID 69306799
(2R,3R,4S,5R)-2-[2-[hydroxymethyl(2-phenylethyl)amino]-6-[(3-iodophenyl)methylamino]purin-9-yl]-5-(2-methyltetrazol-5-yl)oxolane-3,4-diol (PubChem CID 69306799) has the molecular formula C27H29IN10O4 and a molecular weight of 684.50 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[2-[hydroxymethyl(2-phenylethyl)amino]-6-[(3-iodophenyl)methylamino]purin-9-yl]-5-(2-methyltetrazol-5-yl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[2-[hydroxymethyl(2-phenylethyl)amino]-6-[(3-iodophenyl)methylamino]purin-9-yl]-5-(2-methyltetrazol-5-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 69306799 |
| Molecular Formula | C27H29IN10O4 |
| Molecular Weight | 684.50 g/mol |
| Exact Mass | 684.14 |
| IUPAC Name | (2R,3R,4S,5R)-2-[2-[hydroxymethyl(2-phenylethyl)amino]-6-[(3-iodophenyl)methylamino]purin-9-yl]-5-(2-methyltetrazol-5-yl)oxolane-3,4-diol |
| SMILES | Cn1nnc([C@H]2O[C@@H](n3cnc4c(NCc5cccc(I)c5)nc(N(CO)CCc5ccccc5)nc43)[C@H](O)[C@@H]2O)n1 |
| InChI | InChI=1S/C27H29IN10O4/c1-36-34-24(33-35-36)22-20(40)21(41)26(42-22)38-14-30-19-23(29-13-17-8-5-9-18(28)12-17)31-27(32-25(19)38)37(15-39)11-10-16-6-3-2-4-7-16/h2-9,12,14,20-22,26,39-41H,10-11,13,15H2,1H3,(H,29,31,32)/t20-,21+,22-,26+/m0/s1 |
| InChIKey | ZRTRMXNOZYEHAC-IMIIHFCZSA-N |
| XLogP | 1.56 |
| TPSA | 172.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.50 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|