C17H17IN6O5 — CID 164562562
(2S,3S,4R,5R)-N,3,4-trihydroxy-5-[6-[(3-iodophenyl)methylamino]purin-9-yl]oxolane-2-carboxamide (PubChem CID 164562562) has the molecular formula C17H17IN6O5 and a molecular weight of 512.26 g/mol. Its IUPAC name is (2S,3S,4R,5R)-N,3,4-trihydroxy-5-[6-[(3-iodophenyl)methylamino]purin-9-yl]oxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-N,3,4-trihydroxy-5-[6-[(3-iodophenyl)methylamino]purin-9-yl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 164562562 |
| Molecular Formula | C17H17IN6O5 |
| Molecular Weight | 512.26 g/mol |
| Exact Mass | 512.03 |
| IUPAC Name | (2S,3S,4R,5R)-N,3,4-trihydroxy-5-[6-[(3-iodophenyl)methylamino]purin-9-yl]oxolane-2-carboxamide |
| SMILES | O=C(NO)[C@H]1O[C@@H](n2cnc3c(NCc4cccc(I)c4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H17IN6O5/c18-9-3-1-2-8(4-9)5-19-14-10-15(21-6-20-14)24(7-22-10)17-12(26)11(25)13(29-17)16(27)23-28/h1-4,6-7,11-13,17,25-26,28H,5H2,(H,23,27)(H,19,20,21)/t11-,12+,13-,17+/m0/s1 |
| InChIKey | UBAXBHSJERRMFZ-PFHKOEEOSA-N |
| XLogP | 0.17 |
| TPSA | 154.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.26 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|