C18H20N6O7S — CID 46876336
3-[[[9-[(3R,4S,5S)-3,4-dihydroxy-5-(methylcarbamoyl)oxolan-2-yl]purin-6-yl]amino]methyl]benzenesulfonic acid (PubChem CID 46876336) has the molecular formula C18H20N6O7S and a molecular weight of 464.46 g/mol. Its IUPAC name is 3-[[[9-[(3R,4S,5S)-3,4-dihydroxy-5-(methylcarbamoyl)oxolan-2-yl]purin-6-yl]amino]methyl]benzenesulfonic acid.
| Compound Name | 3-[[[9-[(3R,4S,5S)-3,4-dihydroxy-5-(methylcarbamoyl)oxolan-2-yl]purin-6-yl]amino]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 46876336 |
| Molecular Formula | C18H20N6O7S |
| Molecular Weight | 464.46 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 3-[[[9-[(3R,4S,5S)-3,4-dihydroxy-5-(methylcarbamoyl)oxolan-2-yl]purin-6-yl]amino]methyl]benzenesulfonic acid |
| SMILES | CNC(=O)[C@H]1OC(n2cnc3c(NCc4cccc(S(=O)(=O)O)c4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H20N6O7S/c1-19-17(27)14-12(25)13(26)18(31-14)24-8-23-11-15(21-7-22-16(11)24)20-6-9-3-2-4-10(5-9)32(28,29)30/h2-5,7-8,12-14,18,25-26H,6H2,1H3,(H,19,27)(H,20,21,22)(H,28,29,30)/t12-,13+,14-,18?/m0/s1 |
| InChIKey | YLBLAXOLWOEPLP-CDJKEZFESA-N |
| XLogP | -0.95 |
| TPSA | 188.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.46 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|