C21H26N6O4 — CID 164622009
(2S,3S,4R,5R)-3,4-dihydroxy-N-methyl-5-[6-(4-phenylbutylamino)purin-9-yl]oxolane-2-carboxamide (PubChem CID 164622009) has the molecular formula C21H26N6O4 and a molecular weight of 426.48 g/mol. Its IUPAC name is (2S,3S,4R,5R)-3,4-dihydroxy-N-methyl-5-[6-(4-phenylbutylamino)purin-9-yl]oxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-3,4-dihydroxy-N-methyl-5-[6-(4-phenylbutylamino)purin-9-yl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 164622009 |
| Molecular Formula | C21H26N6O4 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | (2S,3S,4R,5R)-3,4-dihydroxy-N-methyl-5-[6-(4-phenylbutylamino)purin-9-yl]oxolane-2-carboxamide |
| SMILES | CNC(=O)[C@H]1O[C@@H](n2cnc3c(NCCCCc4ccccc4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H26N6O4/c1-22-20(30)17-15(28)16(29)21(31-17)27-12-26-14-18(24-11-25-19(14)27)23-10-6-5-9-13-7-3-2-4-8-13/h2-4,7-8,11-12,15-17,21,28-29H,5-6,9-10H2,1H3,(H,22,30)(H,23,24,25)/t15-,16+,17-,21+/m0/s1 |
| InChIKey | OUCYBLQSKFXVIP-GRXQJBFDSA-N |
| XLogP | 0.63 |
| TPSA | 134.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|