C21H24IN6O5- — CID 86640716
(2S,3S,4R,5R)-3,4-dihydroxy-5-[6-[(3-iodophenyl)methylamino]purin-9-yl]-N-methyloxolane-2-carboxamide;prop-1-en-2-olate (PubChem CID 86640716) has the molecular formula C21H24IN6O5- and a molecular weight of 567.36 g/mol. Its IUPAC name is (2S,3S,4R,5R)-3,4-dihydroxy-5-[6-[(3-iodophenyl)methylamino]purin-9-yl]-N-methyloxolane-2-carboxamide;prop-1-en-2-olate.
| Compound Name | (2S,3S,4R,5R)-3,4-dihydroxy-5-[6-[(3-iodophenyl)methylamino]purin-9-yl]-N-methyloxolane-2-carboxamide;prop-1-en-2-olate |
|---|---|
| PubChem CID | 86640716 |
| Molecular Formula | C21H24IN6O5- |
| Molecular Weight | 567.36 g/mol |
| Exact Mass | 567.09 |
| IUPAC Name | (2S,3S,4R,5R)-3,4-dihydroxy-5-[6-[(3-iodophenyl)methylamino]purin-9-yl]-N-methyloxolane-2-carboxamide;prop-1-en-2-olate |
| SMILES | C=C(C)[O-].CNC(=O)[C@H]1O[C@@H](n2cnc3c(NCc4cccc(I)c4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H19IN6O4.C3H6O/c1-20-17(28)14-12(26)13(27)18(29-14)25-8-24-11-15(22-7-23-16(11)25)21-6-9-3-2-4-10(19)5-9;1-3(2)4/h2-5,7-8,12-14,18,26-27H,6H2,1H3,(H,20,28)(H,21,22,23);4H,1H2,2H3/p-1/t12-,13+,14-,18+;/m0./s1 |
| InChIKey | VWZIAHRCQCDDFX-NKOYCVERSA-M |
| XLogP | 0.29 |
| TPSA | 157.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.36 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|