C18H20IN7O4 — CID 164562335
(2S,3S,4R,5R)-3,4-dihydroxy-5-[6-[(3-iodophenyl)methylamino]purin-9-yl]-N'-methyloxolane-2-carbohydrazide (PubChem CID 164562335) has the molecular formula C18H20IN7O4 and a molecular weight of 525.31 g/mol. Its IUPAC name is (2S,3S,4R,5R)-3,4-dihydroxy-5-[6-[(3-iodophenyl)methylamino]purin-9-yl]-N'-methyloxolane-2-carbohydrazide.
| Compound Name | (2S,3S,4R,5R)-3,4-dihydroxy-5-[6-[(3-iodophenyl)methylamino]purin-9-yl]-N'-methyloxolane-2-carbohydrazide |
|---|---|
| PubChem CID | 164562335 |
| Molecular Formula | C18H20IN7O4 |
| Molecular Weight | 525.31 g/mol |
| Exact Mass | 525.06 |
| IUPAC Name | (2S,3S,4R,5R)-3,4-dihydroxy-5-[6-[(3-iodophenyl)methylamino]purin-9-yl]-N'-methyloxolane-2-carbohydrazide |
| SMILES | CNNC(=O)[C@H]1O[C@@H](n2cnc3c(NCc4cccc(I)c4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H20IN7O4/c1-20-25-17(29)14-12(27)13(28)18(30-14)26-8-24-11-15(22-7-23-16(11)26)21-6-9-3-2-4-10(19)5-9/h2-5,7-8,12-14,18,20,27-28H,6H2,1H3,(H,25,29)(H,21,22,23)/t12-,13+,14-,18+/m0/s1 |
| InChIKey | IHZMNWQZKZYKTM-MOROJQBDSA-N |
| XLogP | -0.09 |
| TPSA | 146.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.31 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|