C19H21IN6O3 — CID 10006462
(1S,2R,3S,4R)-2,3-dihydroxy-4-[6-[(3-iodophenyl)methylamino]purin-9-yl]-N-methylcyclopentane-1-carboxamide (PubChem CID 10006462) has the molecular formula C19H21IN6O3 and a molecular weight of 508.32 g/mol. Its IUPAC name is (1S,2R,3S,4R)-2,3-dihydroxy-4-[6-[(3-iodophenyl)methylamino]purin-9-yl]-N-methylcyclopentane-1-carboxamide.
| Compound Name | (1S,2R,3S,4R)-2,3-dihydroxy-4-[6-[(3-iodophenyl)methylamino]purin-9-yl]-N-methylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 10006462 |
| Molecular Formula | C19H21IN6O3 |
| Molecular Weight | 508.32 g/mol |
| Exact Mass | 508.07 |
| IUPAC Name | (1S,2R,3S,4R)-2,3-dihydroxy-4-[6-[(3-iodophenyl)methylamino]purin-9-yl]-N-methylcyclopentane-1-carboxamide |
| SMILES | CNC(=O)[C@H]1C[C@@H](n2cnc3c(NCc4cccc(I)c4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H21IN6O3/c1-21-19(29)12-6-13(16(28)15(12)27)26-9-25-14-17(23-8-24-18(14)26)22-7-10-3-2-4-11(20)5-10/h2-5,8-9,12-13,15-16,27-28H,6-7H2,1H3,(H,21,29)(H,22,23,24)/t12-,13+,15+,16-/m0/s1 |
| InChIKey | RIXRHKHRKDXAQQ-XNISGKROSA-N |
| XLogP | 1.07 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|