C24H22FIN6O3S — CID 46226848
(2S,3S,4R,5R)-N-[(3-fluorophenyl)methyl]-3,4-dihydroxy-5-[6-[(3-iodophenyl)methylamino]purin-9-yl]thiolane-2-carboxamide (PubChem CID 46226848) has the molecular formula C24H22FIN6O3S and a molecular weight of 620.45 g/mol. Its IUPAC name is (2S,3S,4R,5R)-N-[(3-fluorophenyl)methyl]-3,4-dihydroxy-5-[6-[(3-iodophenyl)methylamino]purin-9-yl]thiolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-N-[(3-fluorophenyl)methyl]-3,4-dihydroxy-5-[6-[(3-iodophenyl)methylamino]purin-9-yl]thiolane-2-carboxamide |
|---|---|
| PubChem CID | 46226848 |
| Molecular Formula | C24H22FIN6O3S |
| Molecular Weight | 620.45 g/mol |
| Exact Mass | 620.05 |
| IUPAC Name | (2S,3S,4R,5R)-N-[(3-fluorophenyl)methyl]-3,4-dihydroxy-5-[6-[(3-iodophenyl)methylamino]purin-9-yl]thiolane-2-carboxamide |
| SMILES | O=C(NCc1cccc(F)c1)[C@H]1S[C@@H](n2cnc3c(NCc4cccc(I)c4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H22FIN6O3S/c25-15-5-1-3-13(7-15)10-28-23(35)20-18(33)19(34)24(36-20)32-12-31-17-21(29-11-30-22(17)32)27-9-14-4-2-6-16(26)8-14/h1-8,11-12,18-20,24,33-34H,9-10H2,(H,28,35)(H,27,29,30)/t18-,19+,20-,24+/m0/s1 |
| InChIKey | ALSUSYMBSRYCBR-CMCWBKRRSA-N |
| XLogP | 2.83 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|