C18H18ClIN6O3S — CID 53245158
5-[2-chloro-6-[(3-iodophenyl)methylamino]purin-9-yl]-3,4-dihydroxy-N-methylthiolane-2-carboxamide (PubChem CID 53245158) has the molecular formula C18H18ClIN6O3S and a molecular weight of 560.81 g/mol. Its IUPAC name is 5-[2-chloro-6-[(3-iodophenyl)methylamino]purin-9-yl]-3,4-dihydroxy-N-methylthiolane-2-carboxamide.
| Compound Name | 5-[2-chloro-6-[(3-iodophenyl)methylamino]purin-9-yl]-3,4-dihydroxy-N-methylthiolane-2-carboxamide |
|---|---|
| PubChem CID | 53245158 |
| Molecular Formula | C18H18ClIN6O3S |
| Molecular Weight | 560.81 g/mol |
| Exact Mass | 559.99 |
| IUPAC Name | 5-[2-chloro-6-[(3-iodophenyl)methylamino]purin-9-yl]-3,4-dihydroxy-N-methylthiolane-2-carboxamide |
| SMILES | CNC(=O)C1SC(n2cnc3c(NCc4cccc(I)c4)nc(Cl)nc32)C(O)C1O |
| InChI | InChI=1S/C18H18ClIN6O3S/c1-21-16(29)13-11(27)12(28)17(30-13)26-7-23-10-14(24-18(19)25-15(10)26)22-6-8-3-2-4-9(20)5-8/h2-5,7,11-13,17,27-28H,6H2,1H3,(H,21,29)(H,22,24,25) |
| InChIKey | IRIUFVPPSHYZRM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.81 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|