C20H21IN6O3S — CID 75178558
N-cyclopropyl-3,4-dihydroxy-5-[6-[(3-iodophenyl)methylamino]purin-9-yl]thiolane-2-carboxamide (PubChem CID 75178558) has the molecular formula C20H21IN6O3S and a molecular weight of 552.40 g/mol. Its IUPAC name is N-cyclopropyl-3,4-dihydroxy-5-[6-[(3-iodophenyl)methylamino]purin-9-yl]thiolane-2-carboxamide.
| Compound Name | N-cyclopropyl-3,4-dihydroxy-5-[6-[(3-iodophenyl)methylamino]purin-9-yl]thiolane-2-carboxamide |
|---|---|
| PubChem CID | 75178558 |
| Molecular Formula | C20H21IN6O3S |
| Molecular Weight | 552.40 g/mol |
| Exact Mass | 552.04 |
| IUPAC Name | N-cyclopropyl-3,4-dihydroxy-5-[6-[(3-iodophenyl)methylamino]purin-9-yl]thiolane-2-carboxamide |
| SMILES | O=C(NC1CC1)C1SC(n2cnc3c(NCc4cccc(I)c4)ncnc32)C(O)C1O |
| InChI | InChI=1S/C20H21IN6O3S/c21-11-3-1-2-10(6-11)7-22-17-13-18(24-8-23-17)27(9-25-13)20-15(29)14(28)16(31-20)19(30)26-12-4-5-12/h1-3,6,8-9,12,14-16,20,28-29H,4-5,7H2,(H,26,30)(H,22,23,24) |
| InChIKey | QJASBJLIRRYHNM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.40 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|