C27H25ClN6O6S — CID 168894618
3-[2-[6-[(3-chlorophenyl)methylamino]-9-[(1R,2S,3R,4S)-2,3-dihydroxy-4-(methylcarbamoyl)cyclopentyl]purin-2-yl]ethynyl]benzenesulfonic acid (PubChem CID 168894618) has the molecular formula C27H25ClN6O6S and a molecular weight of 597.05 g/mol. Its IUPAC name is 3-[2-[6-[(3-chlorophenyl)methylamino]-9-[(1R,2S,3R,4S)-2,3-dihydroxy-4-(methylcarbamoyl)cyclopentyl]purin-2-yl]ethynyl]benzenesulfonic acid.
| Compound Name | 3-[2-[6-[(3-chlorophenyl)methylamino]-9-[(1R,2S,3R,4S)-2,3-dihydroxy-4-(methylcarbamoyl)cyclopentyl]purin-2-yl]ethynyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 168894618 |
| Molecular Formula | C27H25ClN6O6S |
| Molecular Weight | 597.05 g/mol |
| Exact Mass | 596.12 |
| IUPAC Name | 3-[2-[6-[(3-chlorophenyl)methylamino]-9-[(1R,2S,3R,4S)-2,3-dihydroxy-4-(methylcarbamoyl)cyclopentyl]purin-2-yl]ethynyl]benzenesulfonic acid |
| SMILES | CNC(=O)[C@H]1C[C@@H](n2cnc3c(NCc4cccc(Cl)c4)nc(C#Cc4cccc(S(=O)(=O)O)c4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H25ClN6O6S/c1-29-27(37)19-12-20(24(36)23(19)35)34-14-31-22-25(30-13-16-5-2-6-17(28)10-16)32-21(33-26(22)34)9-8-15-4-3-7-18(11-15)41(38,39)40/h2-7,10-11,14,19-20,23-24,35-36H,12-13H2,1H3,(H,29,37)(H,30,32,33)(H,38,39,40)/t19-,20+,23+,24-/m0/s1 |
| InChIKey | VPWAVYLVJFSGCZ-TYJFDUFHSA-N |
| XLogP | 1.77 |
| TPSA | 179.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.05 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|