C21H20FN5O3 — CID 164813664
1-[(1S,3S,4R)-4-[2-[2-(4-fluorophenyl)ethynyl]-6-(methylamino)purin-9-yl]-2,3-dihydroxycyclopentyl]ethanone (PubChem CID 164813664) has the molecular formula C21H20FN5O3 and a molecular weight of 409.42 g/mol. Its IUPAC name is 1-[(1S,3S,4R)-4-[2-[2-(4-fluorophenyl)ethynyl]-6-(methylamino)purin-9-yl]-2,3-dihydroxycyclopentyl]ethanone.
| Compound Name | 1-[(1S,3S,4R)-4-[2-[2-(4-fluorophenyl)ethynyl]-6-(methylamino)purin-9-yl]-2,3-dihydroxycyclopentyl]ethanone |
|---|---|
| PubChem CID | 164813664 |
| Molecular Formula | C21H20FN5O3 |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 1-[(1S,3S,4R)-4-[2-[2-(4-fluorophenyl)ethynyl]-6-(methylamino)purin-9-yl]-2,3-dihydroxycyclopentyl]ethanone |
| SMILES | CNc1nc(C#Cc2ccc(F)cc2)nc2c1ncn2[C@@H]1C[C@H](C(C)=O)C(O)[C@H]1O |
| InChI | InChI=1S/C21H20FN5O3/c1-11(28)14-9-15(19(30)18(14)29)27-10-24-17-20(23-2)25-16(26-21(17)27)8-5-12-3-6-13(22)7-4-12/h3-4,6-7,10,14-15,18-19,29-30H,9H2,1-2H3,(H,23,25,26)/t14-,15-,18?,19+/m1/s1 |
| InChIKey | QXXDWZWHFZRIJH-LSZGKNQESA-N |
| XLogP | 1.28 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|