C30H28F2N6O3 — CID 146553496
(2R,3S,4R)-4-[2-[2-(3,4-difluorophenyl)ethynyl]-6-[(2-phenylcyclopropyl)amino]purin-9-yl]-2,3-dihydroxy-N,1-dimethylcyclopentane-1-carboxamide (PubChem CID 146553496) has the molecular formula C30H28F2N6O3 and a molecular weight of 558.59 g/mol. Its IUPAC name is (2R,3S,4R)-4-[2-[2-(3,4-difluorophenyl)ethynyl]-6-[(2-phenylcyclopropyl)amino]purin-9-yl]-2,3-dihydroxy-N,1-dimethylcyclopentane-1-carboxamide.
| Compound Name | (2R,3S,4R)-4-[2-[2-(3,4-difluorophenyl)ethynyl]-6-[(2-phenylcyclopropyl)amino]purin-9-yl]-2,3-dihydroxy-N,1-dimethylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 146553496 |
| Molecular Formula | C30H28F2N6O3 |
| Molecular Weight | 558.59 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | (2R,3S,4R)-4-[2-[2-(3,4-difluorophenyl)ethynyl]-6-[(2-phenylcyclopropyl)amino]purin-9-yl]-2,3-dihydroxy-N,1-dimethylcyclopentane-1-carboxamide |
| SMILES | CNC(=O)C1(C)C[C@@H](n2cnc3c(NC4CC4c4ccccc4)nc(C#Cc4ccc(F)c(F)c4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C30H28F2N6O3/c1-30(29(41)33-2)14-22(25(39)26(30)40)38-15-34-24-27(35-21-13-18(21)17-6-4-3-5-7-17)36-23(37-28(24)38)11-9-16-8-10-19(31)20(32)12-16/h3-8,10,12,15,18,21-22,25-26,39-40H,13-14H2,1-2H3,(H,33,41)(H,35,36,37)/t18?,21?,22-,25+,26+,30?/m1/s1 |
| InChIKey | DLWVOHZQZGSCFM-JBDBZCOTSA-N |
| XLogP | 2.89 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.59 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|