C30H28N6O3 — CID 118707152
(1S,2R,3S,4R,5S)-2,3-dihydroxy-N-methyl-4-[6-[(2-phenylcyclopropyl)amino]-2-(2-phenylethynyl)purin-9-yl]bicyclo[3.1.0]hexane-1-carboxamide (PubChem CID 118707152) has the molecular formula C30H28N6O3 and a molecular weight of 520.59 g/mol. Its IUPAC name is (1S,2R,3S,4R,5S)-2,3-dihydroxy-N-methyl-4-[6-[(2-phenylcyclopropyl)amino]-2-(2-phenylethynyl)purin-9-yl]bicyclo[3.1.0]hexane-1-carboxamide.
| Compound Name | (1S,2R,3S,4R,5S)-2,3-dihydroxy-N-methyl-4-[6-[(2-phenylcyclopropyl)amino]-2-(2-phenylethynyl)purin-9-yl]bicyclo[3.1.0]hexane-1-carboxamide |
|---|---|
| PubChem CID | 118707152 |
| Molecular Formula | C30H28N6O3 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | (1S,2R,3S,4R,5S)-2,3-dihydroxy-N-methyl-4-[6-[(2-phenylcyclopropyl)amino]-2-(2-phenylethynyl)purin-9-yl]bicyclo[3.1.0]hexane-1-carboxamide |
| SMILES | CNC(=O)[C@@]12C[C@@H]1[C@@H](n1cnc3c(NC4CC4c4ccccc4)nc(C#Cc4ccccc4)nc31)[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C30H28N6O3/c1-31-29(39)30-15-20(30)24(25(37)26(30)38)36-16-32-23-27(33-21-14-19(21)18-10-6-3-7-11-18)34-22(35-28(23)36)13-12-17-8-4-2-5-9-17/h2-11,16,19-21,24-26,37-38H,14-15H2,1H3,(H,31,39)(H,33,34,35)/t19?,20-,21?,24-,25+,26+,30+/m1/s1 |
| InChIKey | IMYNAQJHTDJXRP-FPIFLDGGSA-N |
| XLogP | 2.22 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|