C31H30F2N6O3 — CID 144852592
(2R,3S,4R)-4-[2-[2-(3,4-difluorophenyl)ethynyl]-6-[[(2R)-2-phenylcyclopropyl]methylamino]purin-9-yl]-2,3-dihydroxy-N,1-dimethylcyclopentane-1-carboxamide (PubChem CID 144852592) has the molecular formula C31H30F2N6O3 and a molecular weight of 572.62 g/mol. Its IUPAC name is (2R,3S,4R)-4-[2-[2-(3,4-difluorophenyl)ethynyl]-6-[[(2R)-2-phenylcyclopropyl]methylamino]purin-9-yl]-2,3-dihydroxy-N,1-dimethylcyclopentane-1-carboxamide.
| Compound Name | (2R,3S,4R)-4-[2-[2-(3,4-difluorophenyl)ethynyl]-6-[[(2R)-2-phenylcyclopropyl]methylamino]purin-9-yl]-2,3-dihydroxy-N,1-dimethylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 144852592 |
| Molecular Formula | C31H30F2N6O3 |
| Molecular Weight | 572.62 g/mol |
| Exact Mass | 572.23 |
| IUPAC Name | (2R,3S,4R)-4-[2-[2-(3,4-difluorophenyl)ethynyl]-6-[[(2R)-2-phenylcyclopropyl]methylamino]purin-9-yl]-2,3-dihydroxy-N,1-dimethylcyclopentane-1-carboxamide |
| SMILES | CNC(=O)C1(C)C[C@@H](n2cnc3c(NCC4C[C@H]4c4ccccc4)nc(C#Cc4ccc(F)c(F)c4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C31H30F2N6O3/c1-31(30(42)34-2)14-23(26(40)27(31)41)39-16-36-25-28(35-15-19-13-20(19)18-6-4-3-5-7-18)37-24(38-29(25)39)11-9-17-8-10-21(32)22(33)12-17/h3-8,10,12,16,19-20,23,26-27,40-41H,13-15H2,1-2H3,(H,34,42)(H,35,37,38)/t19?,20-,23+,26-,27-,31?/m0/s1 |
| InChIKey | QDTVIYSEGIJKPO-FRAQCLMBSA-N |
| XLogP | 3.14 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.62 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|