C29H31ClN6O5 — CID 44596365
methyl 5-[6-[(3-chlorophenyl)methylamino]-9-[(1S,2R,4R,5S,6R)-8,8-dimethyl-2-(methylcarbamoyl)-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]purin-2-yl]pent-4-ynoate (PubChem CID 44596365) has the molecular formula C29H31ClN6O5 and a molecular weight of 579.06 g/mol. Its IUPAC name is methyl 5-[6-[(3-chlorophenyl)methylamino]-9-[(1S,2R,4R,5S,6R)-8,8-dimethyl-2-(methylcarbamoyl)-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]purin-2-yl]pent-4-ynoate.
| Compound Name | methyl 5-[6-[(3-chlorophenyl)methylamino]-9-[(1S,2R,4R,5S,6R)-8,8-dimethyl-2-(methylcarbamoyl)-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]purin-2-yl]pent-4-ynoate |
|---|---|
| PubChem CID | 44596365 |
| Molecular Formula | C29H31ClN6O5 |
| Molecular Weight | 579.06 g/mol |
| Exact Mass | 578.20 |
| IUPAC Name | methyl 5-[6-[(3-chlorophenyl)methylamino]-9-[(1S,2R,4R,5S,6R)-8,8-dimethyl-2-(methylcarbamoyl)-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]purin-2-yl]pent-4-ynoate |
| SMILES | CNC(=O)[C@]12C[C@H]1[C@H](n1cnc3c(NCc4cccc(Cl)c4)nc(C#CCCC(=O)OC)nc31)[C@H]1OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C29H31ClN6O5/c1-28(2)40-23-22(18-13-29(18,24(23)41-28)27(38)31-3)36-15-33-21-25(32-14-16-8-7-9-17(30)12-16)34-19(35-26(21)36)10-5-6-11-20(37)39-4/h7-9,12,15,18,22-24H,6,11,13-14H2,1-4H3,(H,31,38)(H,32,34,35)/t18-,22-,23+,24+,29+/m0/s1 |
| InChIKey | ZZQNDJCVFJOLAI-AQBZDKCOSA-N |
| XLogP | 3.22 |
| TPSA | 129.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.06 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|