C27H31ClN6O4 — CID 158361808
5-[6-[(3-chlorophenyl)methylamino]-9-[(1S,2R,3R,5S)-5-formyl-3,4-dihydroxy-2-bicyclo[3.1.0]hexanyl]purin-2-yl]-N-ethylpent-4-ynamide;methane (PubChem CID 158361808) has the molecular formula C27H31ClN6O4 and a molecular weight of 539.04 g/mol. Its IUPAC name is 5-[6-[(3-chlorophenyl)methylamino]-9-[(1S,2R,3R,5S)-5-formyl-3,4-dihydroxy-2-bicyclo[3.1.0]hexanyl]purin-2-yl]-N-ethylpent-4-ynamide;methane.
| Compound Name | 5-[6-[(3-chlorophenyl)methylamino]-9-[(1S,2R,3R,5S)-5-formyl-3,4-dihydroxy-2-bicyclo[3.1.0]hexanyl]purin-2-yl]-N-ethylpent-4-ynamide;methane |
|---|---|
| PubChem CID | 158361808 |
| Molecular Formula | C27H31ClN6O4 |
| Molecular Weight | 539.04 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | 5-[6-[(3-chlorophenyl)methylamino]-9-[(1S,2R,3R,5S)-5-formyl-3,4-dihydroxy-2-bicyclo[3.1.0]hexanyl]purin-2-yl]-N-ethylpent-4-ynamide;methane |
| SMILES | C.CCNC(=O)CCC#Cc1nc(NCc2cccc(Cl)c2)c2ncn([C@@H]3[C@H]4C[C@@]4(C=O)C(O)[C@@H]3O)c2n1 |
| InChI | InChI=1S/C26H27ClN6O4.CH4/c1-2-28-19(35)9-4-3-8-18-31-24(29-12-15-6-5-7-16(27)10-15)20-25(32-18)33(14-30-20)21-17-11-26(17,13-34)23(37)22(21)36;/h5-7,10,13-14,17,21-23,36-37H,2,4,9,11-12H2,1H3,(H,28,35)(H,29,31,32);1H4/t17-,21-,22-,23?,26+;/m1./s1 |
| InChIKey | GTOHDSXDWPCTGB-UZMDVIJWSA-N |
| XLogP | 2.48 |
| TPSA | 142.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.04 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|