C28H25ClN4O3S — CID 164985679
1-[(1S,3S,4R)-4-[7-[(3-chlorophenyl)methylamino]-5-[2-(5-methylthiophen-2-yl)ethynyl]imidazo[4,5-b]pyridin-3-yl]-2,3-dihydroxy-1-bicyclo[3.1.0]hexanyl]ethanone (PubChem CID 164985679) has the molecular formula C28H25ClN4O3S and a molecular weight of 533.05 g/mol. Its IUPAC name is 1-[(1S,3S,4R)-4-[7-[(3-chlorophenyl)methylamino]-5-[2-(5-methylthiophen-2-yl)ethynyl]imidazo[4,5-b]pyridin-3-yl]-2,3-dihydroxy-1-bicyclo[3.1.0]hexanyl]ethanone.
| Compound Name | 1-[(1S,3S,4R)-4-[7-[(3-chlorophenyl)methylamino]-5-[2-(5-methylthiophen-2-yl)ethynyl]imidazo[4,5-b]pyridin-3-yl]-2,3-dihydroxy-1-bicyclo[3.1.0]hexanyl]ethanone |
|---|---|
| PubChem CID | 164985679 |
| Molecular Formula | C28H25ClN4O3S |
| Molecular Weight | 533.05 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | 1-[(1S,3S,4R)-4-[7-[(3-chlorophenyl)methylamino]-5-[2-(5-methylthiophen-2-yl)ethynyl]imidazo[4,5-b]pyridin-3-yl]-2,3-dihydroxy-1-bicyclo[3.1.0]hexanyl]ethanone |
| SMILES | CC(=O)[C@@]12CC1[C@@H](n1cnc3c(NCc4cccc(Cl)c4)cc(C#Cc4ccc(C)s4)nc31)[C@H](O)C2O |
| InChI | InChI=1S/C28H25ClN4O3S/c1-15-6-8-20(37-15)9-7-19-11-22(30-13-17-4-3-5-18(29)10-17)23-27(32-19)33(14-31-23)24-21-12-28(21,16(2)34)26(36)25(24)35/h3-6,8,10-11,14,21,24-26,35-36H,12-13H2,1-2H3,(H,30,32)/t21?,24-,25+,26?,28+/m1/s1 |
| InChIKey | PREXCYBJZOYUDK-NQYCSYHISA-N |
| XLogP | 4.34 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.05 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|