C27H29ClN6O5 — CID 45483956
7-[6-[(3-chlorophenyl)methylamino]-9-[(1S,2R,3S,4R,5R)-3,4-dihydroxy-5-(methylcarbamoyl)-2-bicyclo[3.1.0]hexanyl]purin-2-yl]hept-6-ynoic acid (PubChem CID 45483956) has the molecular formula C27H29ClN6O5 and a molecular weight of 553.02 g/mol. Its IUPAC name is 7-[6-[(3-chlorophenyl)methylamino]-9-[(1S,2R,3S,4R,5R)-3,4-dihydroxy-5-(methylcarbamoyl)-2-bicyclo[3.1.0]hexanyl]purin-2-yl]hept-6-ynoic acid.
| Compound Name | 7-[6-[(3-chlorophenyl)methylamino]-9-[(1S,2R,3S,4R,5R)-3,4-dihydroxy-5-(methylcarbamoyl)-2-bicyclo[3.1.0]hexanyl]purin-2-yl]hept-6-ynoic acid |
|---|---|
| PubChem CID | 45483956 |
| Molecular Formula | C27H29ClN6O5 |
| Molecular Weight | 553.02 g/mol |
| Exact Mass | 552.19 |
| IUPAC Name | 7-[6-[(3-chlorophenyl)methylamino]-9-[(1S,2R,3S,4R,5R)-3,4-dihydroxy-5-(methylcarbamoyl)-2-bicyclo[3.1.0]hexanyl]purin-2-yl]hept-6-ynoic acid |
| SMILES | CNC(=O)[C@]12C[C@@H]1[C@@H](n1cnc3c(NCc4cccc(Cl)c4)nc(C#CCCCCC(=O)O)nc31)[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C27H29ClN6O5/c1-29-26(39)27-12-17(27)21(22(37)23(27)38)34-14-31-20-24(30-13-15-7-6-8-16(28)11-15)32-18(33-25(20)34)9-4-2-3-5-10-19(35)36/h6-8,11,14,17,21-23,37-38H,2-3,5,10,12-13H2,1H3,(H,29,39)(H,35,36)(H,30,32,33)/t17-,21-,22+,23+,27-/m1/s1 |
| InChIKey | CHBAZAYEJUYWDY-DXTWCIHJSA-N |
| XLogP | 2.12 |
| TPSA | 162.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.02 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|