C20H21ClIN7O3 — CID 73355960
(1R,2R,3S,4R,5S)-4-[6-[(4-amino-3-iodophenyl)methylamino]-2-chloropurin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide (PubChem CID 73355960) has the molecular formula C20H21ClIN7O3 and a molecular weight of 569.79 g/mol. Its IUPAC name is (1R,2R,3S,4R,5S)-4-[6-[(4-amino-3-iodophenyl)methylamino]-2-chloropurin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide.
| Compound Name | (1R,2R,3S,4R,5S)-4-[6-[(4-amino-3-iodophenyl)methylamino]-2-chloropurin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide |
|---|---|
| PubChem CID | 73355960 |
| Molecular Formula | C20H21ClIN7O3 |
| Molecular Weight | 569.79 g/mol |
| Exact Mass | 569.04 |
| IUPAC Name | (1R,2R,3S,4R,5S)-4-[6-[(4-amino-3-iodophenyl)methylamino]-2-chloropurin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide |
| SMILES | CNC(=O)[C@]12C[C@@H]1[C@@H](n1cnc3c(NCc4ccc(N)c(I)c4)nc(Cl)nc31)[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C20H21ClIN7O3/c1-24-18(32)20-5-9(20)13(14(30)15(20)31)29-7-26-12-16(27-19(21)28-17(12)29)25-6-8-2-3-11(23)10(22)4-8/h2-4,7,9,13-15,30-31H,5-6,23H2,1H3,(H,24,32)(H,25,27,28)/t9-,13-,14+,15+,20-/m1/s1 |
| InChIKey | QCQJRAODDRNEQU-OQVYSTTDSA-N |
| XLogP | 1.31 |
| TPSA | 151.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.79 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|