C16H20ClN5O4 — CID 170795482
(1R,2R,3S,4R,5S)-4-[5-chloro-7-(2-hydroxyethylamino)imidazo[4,5-b]pyridin-3-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide (PubChem CID 170795482) has the molecular formula C16H20ClN5O4 and a molecular weight of 381.82 g/mol. Its IUPAC name is (1R,2R,3S,4R,5S)-4-[5-chloro-7-(2-hydroxyethylamino)imidazo[4,5-b]pyridin-3-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide.
| Compound Name | (1R,2R,3S,4R,5S)-4-[5-chloro-7-(2-hydroxyethylamino)imidazo[4,5-b]pyridin-3-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide |
|---|---|
| PubChem CID | 170795482 |
| Molecular Formula | C16H20ClN5O4 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | (1R,2R,3S,4R,5S)-4-[5-chloro-7-(2-hydroxyethylamino)imidazo[4,5-b]pyridin-3-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide |
| SMILES | CNC(=O)[C@]12C[C@@H]1[C@@H](n1cnc3c(NCCO)cc(Cl)nc31)[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C16H20ClN5O4/c1-18-15(26)16-5-7(16)11(12(24)13(16)25)22-6-20-10-8(19-2-3-23)4-9(17)21-14(10)22/h4,6-7,11-13,23-25H,2-3,5H2,1H3,(H,18,26)(H,19,21)/t7-,11-,12+,13+,16-/m1/s1 |
| InChIKey | JJGRGCHOSVSGIG-SMUUOALFSA-N |
| XLogP | -0.48 |
| TPSA | 132.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|