C22H28ClN5O3 — CID 162735466
(1R,2S,4S,5R,6S)-5-[5-chloro-7-(cyclobutylmethylamino)imidazo[4,5-b]pyridin-3-yl]-N,8,8-trimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonane-2-carboxamide (PubChem CID 162735466) has the molecular formula C22H28ClN5O3 and a molecular weight of 445.95 g/mol. Its IUPAC name is (1R,2S,4S,5R,6S)-5-[5-chloro-7-(cyclobutylmethylamino)imidazo[4,5-b]pyridin-3-yl]-N,8,8-trimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonane-2-carboxamide.
| Compound Name | (1R,2S,4S,5R,6S)-5-[5-chloro-7-(cyclobutylmethylamino)imidazo[4,5-b]pyridin-3-yl]-N,8,8-trimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonane-2-carboxamide |
|---|---|
| PubChem CID | 162735466 |
| Molecular Formula | C22H28ClN5O3 |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | (1R,2S,4S,5R,6S)-5-[5-chloro-7-(cyclobutylmethylamino)imidazo[4,5-b]pyridin-3-yl]-N,8,8-trimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonane-2-carboxamide |
| SMILES | CNC(=O)[C@@]12C[C@@H]1[C@@H](n1cnc3c(NCC4CCC4)cc(Cl)nc31)[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C22H28ClN5O3/c1-21(2)30-17-16(12-8-22(12,18(17)31-21)20(29)24-3)28-10-26-15-13(7-14(23)27-19(15)28)25-9-11-5-4-6-11/h7,10-12,16-18H,4-6,8-9H2,1-3H3,(H,24,29)(H,25,27)/t12-,16-,17+,18+,22+/m1/s1 |
| InChIKey | PQNVPJNVAAQACY-YWNJHDJRSA-N |
| XLogP | 3.12 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|