C15H14Cl2N4O4 — CID 140567418
(1R,4S,5R,6S)-5-(2,6-dichloropurin-9-yl)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonane-2-carboxylic acid (PubChem CID 140567418) has the molecular formula C15H14Cl2N4O4 and a molecular weight of 385.21 g/mol. Its IUPAC name is (1R,4S,5R,6S)-5-(2,6-dichloropurin-9-yl)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonane-2-carboxylic acid.
| Compound Name | (1R,4S,5R,6S)-5-(2,6-dichloropurin-9-yl)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonane-2-carboxylic acid |
|---|---|
| PubChem CID | 140567418 |
| Molecular Formula | C15H14Cl2N4O4 |
| Molecular Weight | 385.21 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | (1R,4S,5R,6S)-5-(2,6-dichloropurin-9-yl)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonane-2-carboxylic acid |
| SMILES | CC1(C)O[C@H]2[C@H](n3cnc4c(Cl)nc(Cl)nc43)[C@H]3CC3(C(=O)O)[C@H]2O1 |
| InChI | InChI=1S/C15H14Cl2N4O4/c1-14(2)24-8-7(5-3-15(5,12(22)23)9(8)25-14)21-4-18-6-10(16)19-13(17)20-11(6)21/h4-5,7-9H,3H2,1-2H3,(H,22,23)/t5-,7-,8+,9+,15?/m1/s1 |
| InChIKey | RFENISHITACJFL-BCMDRMQNSA-N |
| XLogP | 2.30 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.21 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |