C14H16Cl2N4O2S — CID 89296337
2,6-dichloro-9-(6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl)purine (PubChem CID 89296337) has the molecular formula C14H16Cl2N4O2S and a molecular weight of 375.28 g/mol. Its IUPAC name is 2,6-dichloro-9-(6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl)purine.
| Compound Name | 2,6-dichloro-9-(6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl)purine |
|---|---|
| PubChem CID | 89296337 |
| Molecular Formula | C14H16Cl2N4O2S |
| Molecular Weight | 375.28 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | 2,6-dichloro-9-(6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl)purine |
| SMILES | CCC1SC(n2cnc3c(Cl)nc(Cl)nc32)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C14H16Cl2N4O2S/c1-4-6-8-9(22-14(2,3)21-8)12(23-6)20-5-17-7-10(15)18-13(16)19-11(7)20/h5-6,8-9,12H,4H2,1-3H3 |
| InChIKey | XZZZMDCFYFQCAY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.28 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |