C13H13ClN4O2S — CID 170736211
(2R,3R,4S)-2-(2-but-1-ynyl-6-chloropurin-9-yl)thiolane-3,4-diol (PubChem CID 170736211) has the molecular formula C13H13ClN4O2S and a molecular weight of 324.79 g/mol. Its IUPAC name is (2R,3R,4S)-2-(2-but-1-ynyl-6-chloropurin-9-yl)thiolane-3,4-diol.
| Compound Name | (2R,3R,4S)-2-(2-but-1-ynyl-6-chloropurin-9-yl)thiolane-3,4-diol |
|---|---|
| PubChem CID | 170736211 |
| Molecular Formula | C13H13ClN4O2S |
| Molecular Weight | 324.79 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | (2R,3R,4S)-2-(2-but-1-ynyl-6-chloropurin-9-yl)thiolane-3,4-diol |
| SMILES | CCC#Cc1nc(Cl)c2ncn([C@@H]3SC[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C13H13ClN4O2S/c1-2-3-4-8-16-11(14)9-12(17-8)18(6-15-9)13-10(20)7(19)5-21-13/h6-7,10,13,19-20H,2,5H2,1H3/t7-,10-,13-/m1/s1 |
| InChIKey | YUTHLAVWJLFJSH-XBURVNOZSA-N |
| XLogP | 1.21 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.79 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|