C16H16ClN5O2S — CID 146364882
(4R)-2-[6-[(3-chlorophenyl)methylamino]purin-9-yl]thiolane-3,4-diol (PubChem CID 146364882) has the molecular formula C16H16ClN5O2S and a molecular weight of 377.86 g/mol. Its IUPAC name is (4R)-2-[6-[(3-chlorophenyl)methylamino]purin-9-yl]thiolane-3,4-diol.
| Compound Name | (4R)-2-[6-[(3-chlorophenyl)methylamino]purin-9-yl]thiolane-3,4-diol |
|---|---|
| PubChem CID | 146364882 |
| Molecular Formula | C16H16ClN5O2S |
| Molecular Weight | 377.86 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | (4R)-2-[6-[(3-chlorophenyl)methylamino]purin-9-yl]thiolane-3,4-diol |
| SMILES | OC1C(n2cnc3c(NCc4cccc(Cl)c4)ncnc32)SC[C@@H]1O |
| InChI | InChI=1S/C16H16ClN5O2S/c17-10-3-1-2-9(4-10)5-18-14-12-15(20-7-19-14)22(8-21-12)16-13(24)11(23)6-25-16/h1-4,7-8,11,13,16,23-24H,5-6H2,(H,18,19,20)/t11-,13?,16?/m0/s1 |
| InChIKey | CKXSTCOOOXXOLA-XOMBGVMMSA-N |
| XLogP | 2.06 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.86 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |