C16H16BrN5S — CID 141339963
N-[(3-bromophenyl)methyl]-9-(thiolan-2-yl)purin-6-amine (PubChem CID 141339963) has the molecular formula C16H16BrN5S and a molecular weight of 390.31 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-9-(thiolan-2-yl)purin-6-amine.
| Compound Name | N-[(3-bromophenyl)methyl]-9-(thiolan-2-yl)purin-6-amine |
|---|---|
| PubChem CID | 141339963 |
| Molecular Formula | C16H16BrN5S |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-9-(thiolan-2-yl)purin-6-amine |
| SMILES | Brc1cccc(CNc2ncnc3c2ncn3C2CCCS2)c1 |
| InChI | InChI=1S/C16H16BrN5S/c17-12-4-1-3-11(7-12)8-18-15-14-16(20-9-19-15)22(10-21-14)13-5-2-6-23-13/h1,3-4,7,9-10,13H,2,5-6,8H2,(H,18,19,20) |
| InChIKey | DHFZYCQXGHCRJD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |