C17H17F2N5O — CID 136544652
9-cyclopropyl-N-[[3-(2,2-difluoroethoxy)phenyl]methyl]purin-6-amine (PubChem CID 136544652) has the molecular formula C17H17F2N5O and a molecular weight of 345.35 g/mol. Its IUPAC name is 9-cyclopropyl-N-[[3-(2,2-difluoroethoxy)phenyl]methyl]purin-6-amine.
| Compound Name | 9-cyclopropyl-N-[[3-(2,2-difluoroethoxy)phenyl]methyl]purin-6-amine |
|---|---|
| PubChem CID | 136544652 |
| Molecular Formula | C17H17F2N5O |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 9-cyclopropyl-N-[[3-(2,2-difluoroethoxy)phenyl]methyl]purin-6-amine |
| SMILES | FC(F)COc1cccc(CNc2ncnc3c2ncn3C2CC2)c1 |
| InChI | InChI=1S/C17H17F2N5O/c18-14(19)8-25-13-3-1-2-11(6-13)7-20-16-15-17(22-9-21-16)24(10-23-15)12-4-5-12/h1-3,6,9-10,12,14H,4-5,7-8H2,(H,20,21,22) |
| InChIKey | ARZQOCUMSNHLAC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |