C12H12N6S — CID 166246142
9-cyclopropyl-N-(1,2-thiazol-5-ylmethyl)purin-6-amine (PubChem CID 166246142) has the molecular formula C12H12N6S and a molecular weight of 272.34 g/mol. Its IUPAC name is 9-cyclopropyl-N-(1,2-thiazol-5-ylmethyl)purin-6-amine.
| Compound Name | 9-cyclopropyl-N-(1,2-thiazol-5-ylmethyl)purin-6-amine |
|---|---|
| PubChem CID | 166246142 |
| Molecular Formula | C12H12N6S |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 9-cyclopropyl-N-(1,2-thiazol-5-ylmethyl)purin-6-amine |
| SMILES | c1cc(CNc2ncnc3c2ncn3C2CC2)sn1 |
| InChI | InChI=1S/C12H12N6S/c1-2-8(1)18-7-16-10-11(14-6-15-12(10)18)13-5-9-3-4-17-19-9/h3-4,6-8H,1-2,5H2,(H,13,14,15) |
| InChIKey | KDUIUXAKKVUFNW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |