C14H11F2N5 — CID 154829307
9-cyclopropyl-N-(2,3-difluorophenyl)purin-6-amine (PubChem CID 154829307) has the molecular formula C14H11F2N5 and a molecular weight of 287.27 g/mol. Its IUPAC name is 9-cyclopropyl-N-(2,3-difluorophenyl)purin-6-amine.
| Compound Name | 9-cyclopropyl-N-(2,3-difluorophenyl)purin-6-amine |
|---|---|
| PubChem CID | 154829307 |
| Molecular Formula | C14H11F2N5 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 9-cyclopropyl-N-(2,3-difluorophenyl)purin-6-amine |
| SMILES | Fc1cccc(Nc2ncnc3c2ncn3C2CC2)c1F |
| InChI | InChI=1S/C14H11F2N5/c15-9-2-1-3-10(11(9)16)20-13-12-14(18-6-17-13)21(7-19-12)8-4-5-8/h1-3,6-8H,4-5H2,(H,17,18,20) |
| InChIKey | OQYRLTRJMHRTJH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |