C15H12F3N5O — CID 146574673
N-(2,3-difluorophenyl)-2-fluoro-9-(oxolan-2-yl)purin-6-amine (PubChem CID 146574673) has the molecular formula C15H12F3N5O and a molecular weight of 335.29 g/mol. Its IUPAC name is N-(2,3-difluorophenyl)-2-fluoro-9-(oxolan-2-yl)purin-6-amine.
| Compound Name | N-(2,3-difluorophenyl)-2-fluoro-9-(oxolan-2-yl)purin-6-amine |
|---|---|
| PubChem CID | 146574673 |
| Molecular Formula | C15H12F3N5O |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | N-(2,3-difluorophenyl)-2-fluoro-9-(oxolan-2-yl)purin-6-amine |
| SMILES | Fc1nc(Nc2cccc(F)c2F)c2ncn(C3CCCO3)c2n1 |
| InChI | InChI=1S/C15H12F3N5O/c16-8-3-1-4-9(11(8)17)20-13-12-14(22-15(18)21-13)23(7-19-12)10-5-2-6-24-10/h1,3-4,7,10H,2,5-6H2,(H,20,21,22) |
| InChIKey | MYXKHOLQRLVNMO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |