C15H13ClFN5O — CID 146575044
N-(2-chlorophenyl)-2-fluoro-9-(oxolan-2-yl)purin-6-amine (PubChem CID 146575044) has the molecular formula C15H13ClFN5O and a molecular weight of 333.75 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-fluoro-9-(oxolan-2-yl)purin-6-amine.
| Compound Name | N-(2-chlorophenyl)-2-fluoro-9-(oxolan-2-yl)purin-6-amine |
|---|---|
| PubChem CID | 146575044 |
| Molecular Formula | C15H13ClFN5O |
| Molecular Weight | 333.75 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | N-(2-chlorophenyl)-2-fluoro-9-(oxolan-2-yl)purin-6-amine |
| SMILES | Fc1nc(Nc2ccccc2Cl)c2ncn(C3CCCO3)c2n1 |
| InChI | InChI=1S/C15H13ClFN5O/c16-9-4-1-2-5-10(9)19-13-12-14(21-15(17)20-13)22(8-18-12)11-6-3-7-23-11/h1-2,4-5,8,11H,3,6-7H2,(H,19,20,21) |
| InChIKey | VDLCOIUCHIJAMN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.75 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |