C18H20FN5O4 — CID 162441190
2-fluoro-9-(oxolan-2-yl)-N-(2,3,5-trimethoxyphenyl)purin-6-amine (PubChem CID 162441190) has the molecular formula C18H20FN5O4 and a molecular weight of 389.39 g/mol. Its IUPAC name is 2-fluoro-9-(oxolan-2-yl)-N-(2,3,5-trimethoxyphenyl)purin-6-amine.
| Compound Name | 2-fluoro-9-(oxolan-2-yl)-N-(2,3,5-trimethoxyphenyl)purin-6-amine |
|---|---|
| PubChem CID | 162441190 |
| Molecular Formula | C18H20FN5O4 |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 2-fluoro-9-(oxolan-2-yl)-N-(2,3,5-trimethoxyphenyl)purin-6-amine |
| SMILES | COc1cc(Nc2nc(F)nc3c2ncn3C2CCCO2)c(OC)c(OC)c1 |
| InChI | InChI=1S/C18H20FN5O4/c1-25-10-7-11(15(27-3)12(8-10)26-2)21-16-14-17(23-18(19)22-16)24(9-20-14)13-5-4-6-28-13/h7-9,13H,4-6H2,1-3H3,(H,21,22,23) |
| InChIKey | SVYBZLSGCLRMLA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |