C19H22FN5O3 — CID 162440937
N-(2,3-dimethoxyphenyl)-2-fluoro-9-(oxepan-2-yl)purin-6-amine (PubChem CID 162440937) has the molecular formula C19H22FN5O3 and a molecular weight of 387.42 g/mol. Its IUPAC name is N-(2,3-dimethoxyphenyl)-2-fluoro-9-(oxepan-2-yl)purin-6-amine.
| Compound Name | N-(2,3-dimethoxyphenyl)-2-fluoro-9-(oxepan-2-yl)purin-6-amine |
|---|---|
| PubChem CID | 162440937 |
| Molecular Formula | C19H22FN5O3 |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | N-(2,3-dimethoxyphenyl)-2-fluoro-9-(oxepan-2-yl)purin-6-amine |
| SMILES | COc1cccc(Nc2nc(F)nc3c2ncn3C2CCCCCO2)c1OC |
| InChI | InChI=1S/C19H22FN5O3/c1-26-13-8-6-7-12(16(13)27-2)22-17-15-18(24-19(20)23-17)25(11-21-15)14-9-4-3-5-10-28-14/h6-8,11,14H,3-5,9-10H2,1-2H3,(H,22,23,24) |
| InChIKey | CMNRTPKSOGQCSU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 83.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |