C18H20BrN5O3 — CID 146574607
2-bromo-N-(2,3-dimethoxyphenyl)-9-(oxan-2-yl)purin-6-amine (PubChem CID 146574607) has the molecular formula C18H20BrN5O3 and a molecular weight of 434.29 g/mol. Its IUPAC name is 2-bromo-N-(2,3-dimethoxyphenyl)-9-(oxan-2-yl)purin-6-amine.
| Compound Name | 2-bromo-N-(2,3-dimethoxyphenyl)-9-(oxan-2-yl)purin-6-amine |
|---|---|
| PubChem CID | 146574607 |
| Molecular Formula | C18H20BrN5O3 |
| Molecular Weight | 434.29 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | 2-bromo-N-(2,3-dimethoxyphenyl)-9-(oxan-2-yl)purin-6-amine |
| SMILES | COc1cccc(Nc2nc(Br)nc3c2ncn3C2CCCCO2)c1OC |
| InChI | InChI=1S/C18H20BrN5O3/c1-25-12-7-5-6-11(15(12)26-2)21-16-14-17(23-18(19)22-16)24(10-20-14)13-8-3-4-9-27-13/h5-7,10,13H,3-4,8-9H2,1-2H3,(H,21,22,23) |
| InChIKey | HWMKMAKYWGPZPJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 83.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.29 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |