C15H12BrCl2N5O — CID 146574899
2-bromo-N-(2,3-dichlorophenyl)-9-(oxolan-2-yl)purin-6-amine (PubChem CID 146574899) has the molecular formula C15H12BrCl2N5O and a molecular weight of 429.11 g/mol. Its IUPAC name is 2-bromo-N-(2,3-dichlorophenyl)-9-(oxolan-2-yl)purin-6-amine.
| Compound Name | 2-bromo-N-(2,3-dichlorophenyl)-9-(oxolan-2-yl)purin-6-amine |
|---|---|
| PubChem CID | 146574899 |
| Molecular Formula | C15H12BrCl2N5O |
| Molecular Weight | 429.11 g/mol |
| Exact Mass | 426.96 |
| IUPAC Name | 2-bromo-N-(2,3-dichlorophenyl)-9-(oxolan-2-yl)purin-6-amine |
| SMILES | Clc1cccc(Nc2nc(Br)nc3c2ncn3C2CCCO2)c1Cl |
| InChI | InChI=1S/C15H12BrCl2N5O/c16-15-21-13(20-9-4-1-3-8(17)11(9)18)12-14(22-15)23(7-19-12)10-5-2-6-24-10/h1,3-4,7,10H,2,5-6H2,(H,20,21,22) |
| InChIKey | KKWLHDAVTMAQSA-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.11 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |