C15H15BrN6O — CID 146574948
6-N-(2-bromophenyl)-9-(oxolan-2-yl)purine-2,6-diamine (PubChem CID 146574948) has the molecular formula C15H15BrN6O and a molecular weight of 375.23 g/mol. Its IUPAC name is 6-N-(2-bromophenyl)-9-(oxolan-2-yl)purine-2,6-diamine.
| Compound Name | 6-N-(2-bromophenyl)-9-(oxolan-2-yl)purine-2,6-diamine |
|---|---|
| PubChem CID | 146574948 |
| Molecular Formula | C15H15BrN6O |
| Molecular Weight | 375.23 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 6-N-(2-bromophenyl)-9-(oxolan-2-yl)purine-2,6-diamine |
| SMILES | Nc1nc(Nc2ccccc2Br)c2ncn(C3CCCO3)c2n1 |
| InChI | InChI=1S/C15H15BrN6O/c16-9-4-1-2-5-10(9)19-13-12-14(21-15(17)20-13)22(8-18-12)11-6-3-7-23-11/h1-2,4-5,8,11H,3,6-7H2,(H3,17,19,20,21) |
| InChIKey | MWOGVKJNKDRLOH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.23 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |