C17H18ClN5O2 — CID 146574952
2-chloro-N-(2-ethoxyphenyl)-9-(oxolan-2-yl)purin-6-amine (PubChem CID 146574952) has the molecular formula C17H18ClN5O2 and a molecular weight of 359.82 g/mol. Its IUPAC name is 2-chloro-N-(2-ethoxyphenyl)-9-(oxolan-2-yl)purin-6-amine.
| Compound Name | 2-chloro-N-(2-ethoxyphenyl)-9-(oxolan-2-yl)purin-6-amine |
|---|---|
| PubChem CID | 146574952 |
| Molecular Formula | C17H18ClN5O2 |
| Molecular Weight | 359.82 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 2-chloro-N-(2-ethoxyphenyl)-9-(oxolan-2-yl)purin-6-amine |
| SMILES | CCOc1ccccc1Nc1nc(Cl)nc2c1ncn2C1CCCO1 |
| InChI | InChI=1S/C17H18ClN5O2/c1-2-24-12-7-4-3-6-11(12)20-15-14-16(22-17(18)21-15)23(10-19-14)13-8-5-9-25-13/h3-4,6-7,10,13H,2,5,8-9H2,1H3,(H,20,21,22) |
| InChIKey | CNLFALZERCSOKD-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.82 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |