C15H14ClN5O2 — CID 146574627
3-[[2-chloro-9-(oxolan-2-yl)purin-6-yl]amino]phenol (PubChem CID 146574627) has the molecular formula C15H14ClN5O2 and a molecular weight of 331.76 g/mol. Its IUPAC name is 3-[[2-chloro-9-(oxolan-2-yl)purin-6-yl]amino]phenol.
| Compound Name | 3-[[2-chloro-9-(oxolan-2-yl)purin-6-yl]amino]phenol |
|---|---|
| PubChem CID | 146574627 |
| Molecular Formula | C15H14ClN5O2 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 3-[[2-chloro-9-(oxolan-2-yl)purin-6-yl]amino]phenol |
| SMILES | Oc1cccc(Nc2nc(Cl)nc3c2ncn3C2CCCO2)c1 |
| InChI | InChI=1S/C15H14ClN5O2/c16-15-19-13(18-9-3-1-4-10(22)7-9)12-14(20-15)21(8-17-12)11-5-2-6-23-11/h1,3-4,7-8,11,22H,2,5-6H2,(H,18,19,20) |
| InChIKey | PSVIYSYWZFEEJJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |