C26H32Cl2N10O2 — CID 59343091
1-N,4-N-bis[2-chloro-9-(oxan-2-yl)purin-6-yl]cyclohexane-1,4-diamine (PubChem CID 59343091) has the molecular formula C26H32Cl2N10O2 and a molecular weight of 587.52 g/mol. Its IUPAC name is 1-N,4-N-bis[2-chloro-9-(oxan-2-yl)purin-6-yl]cyclohexane-1,4-diamine.
| Compound Name | 1-N,4-N-bis[2-chloro-9-(oxan-2-yl)purin-6-yl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 59343091 |
| Molecular Formula | C26H32Cl2N10O2 |
| Molecular Weight | 587.52 g/mol |
| Exact Mass | 586.21 |
| IUPAC Name | 1-N,4-N-bis[2-chloro-9-(oxan-2-yl)purin-6-yl]cyclohexane-1,4-diamine |
| SMILES | Clc1nc(NC2CCC(Nc3nc(Cl)nc4c3ncn4C3CCCCO3)CC2)c2ncn(C3CCCCO3)c2n1 |
| InChI | InChI=1S/C26H32Cl2N10O2/c27-25-33-21(19-23(35-25)37(13-29-19)17-5-1-3-11-39-17)31-15-7-9-16(10-8-15)32-22-20-24(36-26(28)34-22)38(14-30-20)18-6-2-4-12-40-18/h13-18H,1-12H2,(H,31,33,35)(H,32,34,36) |
| InChIKey | SRIAOMWCOZTYCD-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.52 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |