C13H15ClF3N5O — CID 175035843
2-chloro-9-(oxan-2-yl)-N-(3,3,3-trifluoropropyl)purin-6-amine (PubChem CID 175035843) has the molecular formula C13H15ClF3N5O and a molecular weight of 349.74 g/mol. Its IUPAC name is 2-chloro-9-(oxan-2-yl)-N-(3,3,3-trifluoropropyl)purin-6-amine.
| Compound Name | 2-chloro-9-(oxan-2-yl)-N-(3,3,3-trifluoropropyl)purin-6-amine |
|---|---|
| PubChem CID | 175035843 |
| Molecular Formula | C13H15ClF3N5O |
| Molecular Weight | 349.74 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 2-chloro-9-(oxan-2-yl)-N-(3,3,3-trifluoropropyl)purin-6-amine |
| SMILES | FC(F)(F)CCNc1nc(Cl)nc2c1ncn2C1CCCCO1 |
| InChI | InChI=1S/C13H15ClF3N5O/c14-12-20-10(18-5-4-13(15,16)17)9-11(21-12)22(7-19-9)8-3-1-2-6-23-8/h7-8H,1-6H2,(H,18,20,21) |
| InChIKey | GEUXNYWRPJZYDR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.74 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |