C17H15F4N5O — CID 162441159
2-fluoro-9-(oxan-2-yl)-N-[(3,4,5-trifluorophenyl)methyl]purin-6-amine (PubChem CID 162441159) has the molecular formula C17H15F4N5O and a molecular weight of 381.33 g/mol. Its IUPAC name is 2-fluoro-9-(oxan-2-yl)-N-[(3,4,5-trifluorophenyl)methyl]purin-6-amine.
| Compound Name | 2-fluoro-9-(oxan-2-yl)-N-[(3,4,5-trifluorophenyl)methyl]purin-6-amine |
|---|---|
| PubChem CID | 162441159 |
| Molecular Formula | C17H15F4N5O |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 2-fluoro-9-(oxan-2-yl)-N-[(3,4,5-trifluorophenyl)methyl]purin-6-amine |
| SMILES | Fc1nc(NCc2cc(F)c(F)c(F)c2)c2ncn(C3CCCCO3)c2n1 |
| InChI | InChI=1S/C17H15F4N5O/c18-10-5-9(6-11(19)13(10)20)7-22-15-14-16(25-17(21)24-15)26(8-23-14)12-3-1-2-4-27-12/h5-6,8,12H,1-4,7H2,(H,22,24,25) |
| InChIKey | BNYNFCZQMQZJQD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|