C15H13F2N5O — CID 162441059
2-fluoro-N-[(4-fluorophenyl)methyl]-9-(oxetan-2-yl)purin-6-amine (PubChem CID 162441059) has the molecular formula C15H13F2N5O and a molecular weight of 317.30 g/mol. Its IUPAC name is 2-fluoro-N-[(4-fluorophenyl)methyl]-9-(oxetan-2-yl)purin-6-amine.
| Compound Name | 2-fluoro-N-[(4-fluorophenyl)methyl]-9-(oxetan-2-yl)purin-6-amine |
|---|---|
| PubChem CID | 162441059 |
| Molecular Formula | C15H13F2N5O |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 2-fluoro-N-[(4-fluorophenyl)methyl]-9-(oxetan-2-yl)purin-6-amine |
| SMILES | Fc1ccc(CNc2nc(F)nc3c2ncn3C2CCO2)cc1 |
| InChI | InChI=1S/C15H13F2N5O/c16-10-3-1-9(2-4-10)7-18-13-12-14(21-15(17)20-13)22(8-19-12)11-5-6-23-11/h1-4,8,11H,5-7H2,(H,18,20,21) |
| InChIKey | MVAVRRCWMZTDTB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |