C14H14FN5O2 — CID 162440928
2-fluoro-N-[(5-methylfuran-2-yl)methyl]-9-(oxetan-2-yl)purin-6-amine (PubChem CID 162440928) has the molecular formula C14H14FN5O2 and a molecular weight of 303.30 g/mol. Its IUPAC name is 2-fluoro-N-[(5-methylfuran-2-yl)methyl]-9-(oxetan-2-yl)purin-6-amine.
| Compound Name | 2-fluoro-N-[(5-methylfuran-2-yl)methyl]-9-(oxetan-2-yl)purin-6-amine |
|---|---|
| PubChem CID | 162440928 |
| Molecular Formula | C14H14FN5O2 |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2-fluoro-N-[(5-methylfuran-2-yl)methyl]-9-(oxetan-2-yl)purin-6-amine |
| SMILES | Cc1ccc(CNc2nc(F)nc3c2ncn3C2CCO2)o1 |
| InChI | InChI=1S/C14H14FN5O2/c1-8-2-3-9(22-8)6-16-12-11-13(19-14(15)18-12)20(7-17-11)10-4-5-21-10/h2-3,7,10H,4-6H2,1H3,(H,16,18,19) |
| InChIKey | RKOCAYRURPJHKG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 78.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |