C17H18FN5O3 — CID 162440960
2-[[[2-fluoro-9-(oxan-2-yl)purin-6-yl]amino]methyl]benzene-1,4-diol (PubChem CID 162440960) has the molecular formula C17H18FN5O3 and a molecular weight of 359.36 g/mol. Its IUPAC name is 2-[[[2-fluoro-9-(oxan-2-yl)purin-6-yl]amino]methyl]benzene-1,4-diol.
| Compound Name | 2-[[[2-fluoro-9-(oxan-2-yl)purin-6-yl]amino]methyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 162440960 |
| Molecular Formula | C17H18FN5O3 |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 2-[[[2-fluoro-9-(oxan-2-yl)purin-6-yl]amino]methyl]benzene-1,4-diol |
| SMILES | Oc1ccc(O)c(CNc2nc(F)nc3c2ncn3C2CCCCO2)c1 |
| InChI | InChI=1S/C17H18FN5O3/c18-17-21-15(19-8-10-7-11(24)4-5-12(10)25)14-16(22-17)23(9-20-14)13-3-1-2-6-26-13/h4-5,7,9,13,24-25H,1-3,6,8H2,(H,19,21,22) |
| InChIKey | IAGCMMQIHLEIIV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|