C17H18FN5O2 — CID 162441030
2-fluoro-N-[(3-methoxyphenyl)methyl]-9-(oxolan-2-yl)purin-6-amine (PubChem CID 162441030) has the molecular formula C17H18FN5O2 and a molecular weight of 343.36 g/mol. Its IUPAC name is 2-fluoro-N-[(3-methoxyphenyl)methyl]-9-(oxolan-2-yl)purin-6-amine.
| Compound Name | 2-fluoro-N-[(3-methoxyphenyl)methyl]-9-(oxolan-2-yl)purin-6-amine |
|---|---|
| PubChem CID | 162441030 |
| Molecular Formula | C17H18FN5O2 |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 2-fluoro-N-[(3-methoxyphenyl)methyl]-9-(oxolan-2-yl)purin-6-amine |
| SMILES | COc1cccc(CNc2nc(F)nc3c2ncn3C2CCCO2)c1 |
| InChI | InChI=1S/C17H18FN5O2/c1-24-12-5-2-4-11(8-12)9-19-15-14-16(22-17(18)21-15)23(10-20-14)13-6-3-7-25-13/h2,4-5,8,10,13H,3,6-7,9H2,1H3,(H,19,21,22) |
| InChIKey | OZGFUMVIOKPNKZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |